C10H13N3O — CID 59897267
(E,2E)-2-hydrazinylidene-N-methoxy-1-phenylpropan-1-imine (PubChem CID 59897267) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is (E,2E)-2-hydrazinylidene-N-methoxy-1-phenylpropan-1-imine.
| Compound Name | (E,2E)-2-hydrazinylidene-N-methoxy-1-phenylpropan-1-imine |
|---|---|
| PubChem CID | 59897267 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (E,2E)-2-hydrazinylidene-N-methoxy-1-phenylpropan-1-imine |
| SMILES | CO/N=C(C(/C)=N/N)\c1ccccc1 |
| InChI | InChI=1S/C10H13N3O/c1-8(12-11)10(13-14-2)9-6-4-3-5-7-9/h3-7H,11H2,1-2H3/b12-8+,13-10- |
| InChIKey | DIAWMLHWZYMQHN-LSCZQMSZSA-N |
| XLogP | 1.37 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|