C18H20N2O2 — CID 87328023
(Z)-N,N'-dimethoxy-1,4-diphenylbutane-1,4-diimine (PubChem CID 87328023) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (Z)-N,N'-dimethoxy-1,4-diphenylbutane-1,4-diimine.
| Compound Name | (Z)-N,N'-dimethoxy-1,4-diphenylbutane-1,4-diimine |
|---|---|
| PubChem CID | 87328023 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (Z)-N,N'-dimethoxy-1,4-diphenylbutane-1,4-diimine |
| SMILES | CO/N=C(/CC/C(=N/OC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c1-21-19-17(15-9-5-3-6-10-15)13-14-18(20-22-2)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3/b19-17-,20-18- |
| InChIKey | MMDUZOQDSVQOPR-CLFAGFIQSA-N |
| XLogP | 3.87 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|