C52H44N2O2Si2 — CID 154048211
1,4-diphenyl-N,N'-bis(triphenylsilyloxy)butane-1,4-diimine (PubChem CID 154048211) has the molecular formula C52H44N2O2Si2 and a molecular weight of 785.11 g/mol. Its IUPAC name is 1,4-diphenyl-N,N'-bis(triphenylsilyloxy)butane-1,4-diimine.
| Compound Name | 1,4-diphenyl-N,N'-bis(triphenylsilyloxy)butane-1,4-diimine |
|---|---|
| PubChem CID | 154048211 |
| Molecular Formula | C52H44N2O2Si2 |
| Molecular Weight | 785.11 g/mol |
| Exact Mass | 784.29 |
| IUPAC Name | 1,4-diphenyl-N,N'-bis(triphenylsilyloxy)butane-1,4-diimine |
| SMILES | c1ccc(C(CCC(=NO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc2)=NO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H44N2O2Si2/c1-9-25-43(26-10-1)51(53-55-57(45-29-13-3-14-30-45,46-31-15-4-16-32-46)47-33-17-5-18-34-47)41-42-52(44-27-11-2-12-28-44)54-56-58(48-35-19-6-20-36-48,49-37-21-7-22-38-49)50-39-23-8-24-40-50/h1-40H,41-42H2 |
| InChIKey | BQFLONQTGQVWGW-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.11 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|