C23H21NO2 — CID 88532291
(4Z)-1,4-diphenyl-4-phenylmethoxyiminobutan-1-one (PubChem CID 88532291) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (4Z)-1,4-diphenyl-4-phenylmethoxyiminobutan-1-one.
| Compound Name | (4Z)-1,4-diphenyl-4-phenylmethoxyiminobutan-1-one |
|---|---|
| PubChem CID | 88532291 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (4Z)-1,4-diphenyl-4-phenylmethoxyiminobutan-1-one |
| SMILES | O=C(CC/C(=N/OCc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO2/c25-23(21-14-8-3-9-15-21)17-16-22(20-12-6-2-7-13-20)24-26-18-19-10-4-1-5-11-19/h1-15H,16-18H2/b24-22- |
| InChIKey | BHPFUIQSKGQMCW-GYHWCHFESA-N |
| XLogP | 5.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|