C18H18O2 — CID 70896086
1,6-diphenylhexane-1,4-dione (PubChem CID 70896086) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,6-diphenylhexane-1,4-dione.
| Compound Name | 1,6-diphenylhexane-1,4-dione |
|---|---|
| PubChem CID | 70896086 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1,6-diphenylhexane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C18H18O2/c19-17(12-11-15-7-3-1-4-8-15)13-14-18(20)16-9-5-2-6-10-16/h1-10H,11-14H2 |
| InChIKey | GWJLKZYHQZWFOS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |