C15H14O — CID 23727371
2,2-dideuterio-1,3-diphenylpropan-1-one (PubChem CID 23727371) has the molecular formula C15H14O and a molecular weight of 212.29 g/mol. Its IUPAC name is 2,2-dideuterio-1,3-diphenylpropan-1-one.
| Compound Name | 2,2-dideuterio-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 23727371 |
| Molecular Formula | C15H14O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2,2-dideuterio-1,3-diphenylpropan-1-one |
| SMILES | [2H]C([2H])(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2/i12D2 |
| InChIKey | QGGZBXOADPVUPN-XUWBISKJSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |