About (2R)-2-deuterio-1,2-diphenylethanone
(2R)-2-deuterio-1,2-diphenylethanone (PubChem CID 138962790) has the molecular formula C14H12O
and a molecular weight of 197.26 g/mol. Its IUPAC name is (2R)-2-deuterio-1,2-diphenylethanone.
Molecular Properties
| Compound Name | (2R)-2-deuterio-1,2-diphenylethanone |
| PubChem CID | 138962790 |
| Molecular Formula | C14H12O |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2R)-2-deuterio-1,2-diphenylethanone |
| SMILES | [2H][C@@H](C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2/i11D/t11-/m1/s1 |
| InChIKey | OTKCEEWUXHVZQI-IFGNIZEASA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-deuterio-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-deuterio-1,2-diphenylethanone?
The IUPAC name of (2R)-2-deuterio-1,2-diphenylethanone (CID 138962790) is (2R)-2-deuterio-1,2-diphenylethanone.
What is the SMILES notation for (2R)-2-deuterio-1,2-diphenylethanone?
The canonical SMILES for (2R)-2-deuterio-1,2-diphenylethanone is [2H][C@@H](C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-2-deuterio-1,2-diphenylethanone?
The InChIKey is OTKCEEWUXHVZQI-IFGNIZEASA-N. The full InChI is InChI=1S/C14H12O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2/i11D/t11-/m1/s1.
What are the key properties of (2R)-2-deuterio-1,2-diphenylethanone?
(2R)-2-deuterio-1,2-diphenylethanone has a molecular weight of 197.26 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-deuterio-1,2-diphenylethanone is sourced from PubChem (CID 138962790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).