About 1,2-diphenylethanone;diphenylmethanone
1,2-diphenylethanone;diphenylmethanone (PubChem CID 141067729) has the molecular formula C27H22O2
and a molecular weight of 378.47 g/mol. Its IUPAC name is 1,2-diphenylethanone;diphenylmethanone.
Molecular Properties
| Compound Name | 1,2-diphenylethanone;diphenylmethanone |
| PubChem CID | 141067729 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1,2-diphenylethanone;diphenylmethanone |
| SMILES | O=C(Cc1ccccc1)c1ccccc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O.C13H10O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,11H2;1-10H |
| InChIKey | AYZJHUAOBHFJRP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-diphenylethanone;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylethanone;diphenylmethanone?
The IUPAC name of 1,2-diphenylethanone;diphenylmethanone (CID 141067729) is 1,2-diphenylethanone;diphenylmethanone.
What is the SMILES notation for 1,2-diphenylethanone;diphenylmethanone?
The canonical SMILES for 1,2-diphenylethanone;diphenylmethanone is O=C(Cc1ccccc1)c1ccccc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,2-diphenylethanone;diphenylmethanone?
The InChIKey is AYZJHUAOBHFJRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O.C13H10O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,11H2;1-10H.
What are the key properties of 1,2-diphenylethanone;diphenylmethanone?
1,2-diphenylethanone;diphenylmethanone has a molecular weight of 378.47 g/mol, XLogP of 6.03, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylethanone;diphenylmethanone is sourced from PubChem (CID 141067729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).