About 4-phenacylbenzoyl iodide
4-phenacylbenzoyl iodide (PubChem CID 142013538) has the molecular formula C15H11IO2
and a molecular weight of 350.16 g/mol. Its IUPAC name is 4-phenacylbenzoyl iodide.
Molecular Properties
| Compound Name | 4-phenacylbenzoyl iodide |
| PubChem CID | 142013538 |
| Molecular Formula | C15H11IO2 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 4-phenacylbenzoyl iodide |
| SMILES | O=C(I)c1ccc(CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H11IO2/c16-15(18)13-8-6-11(7-9-13)10-14(17)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | IRKWMTSUBNKNHF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-phenacylbenzoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenacylbenzoyl iodide?
The IUPAC name of 4-phenacylbenzoyl iodide (CID 142013538) is 4-phenacylbenzoyl iodide.
What is the SMILES notation for 4-phenacylbenzoyl iodide?
The canonical SMILES for 4-phenacylbenzoyl iodide is O=C(I)c1ccc(CC(=O)c2ccccc2)cc1.
What is the InChIKey of 4-phenacylbenzoyl iodide?
The InChIKey is IRKWMTSUBNKNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11IO2/c16-15(18)13-8-6-11(7-9-13)10-14(17)12-4-2-1-3-5-12/h1-9H,10H2.
What are the key properties of 4-phenacylbenzoyl iodide?
4-phenacylbenzoyl iodide has a molecular weight of 350.16 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenacylbenzoyl iodide is sourced from PubChem (CID 142013538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).