About bromomethylbenzene;diphenylmethanone
bromomethylbenzene;diphenylmethanone (PubChem CID 159613438) has the molecular formula C20H17BrO
and a molecular weight of 353.26 g/mol. Its IUPAC name is bromomethylbenzene;diphenylmethanone.
Molecular Properties
| Compound Name | bromomethylbenzene;diphenylmethanone |
| PubChem CID | 159613438 |
| Molecular Formula | C20H17BrO |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | bromomethylbenzene;diphenylmethanone |
| SMILES | BrCc1ccccc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C7H7Br/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10H;1-5H,6H2 |
| InChIKey | MMZMDLROCWBKKO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethylbenzene;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethylbenzene;diphenylmethanone?
The IUPAC name of bromomethylbenzene;diphenylmethanone (CID 159613438) is bromomethylbenzene;diphenylmethanone.
What is the SMILES notation for bromomethylbenzene;diphenylmethanone?
The canonical SMILES for bromomethylbenzene;diphenylmethanone is BrCc1ccccc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of bromomethylbenzene;diphenylmethanone?
The InChIKey is MMZMDLROCWBKKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C7H7Br/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10H;1-5H,6H2.
What are the key properties of bromomethylbenzene;diphenylmethanone?
bromomethylbenzene;diphenylmethanone has a molecular weight of 353.26 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethylbenzene;diphenylmethanone is sourced from PubChem (CID 159613438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).