C24H24N2O2 — CID 87328837
1-phenyl-1-N,3-N-bis(phenylmethoxy)butane-1,3-diimine (PubChem CID 87328837) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-phenyl-1-N,3-N-bis(phenylmethoxy)butane-1,3-diimine.
| Compound Name | 1-phenyl-1-N,3-N-bis(phenylmethoxy)butane-1,3-diimine |
|---|---|
| PubChem CID | 87328837 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-phenyl-1-N,3-N-bis(phenylmethoxy)butane-1,3-diimine |
| SMILES | CC(CC(=NOCc1ccccc1)c1ccccc1)=NOCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O2/c1-20(25-27-18-21-11-5-2-6-12-21)17-24(23-15-9-4-10-16-23)26-28-19-22-13-7-3-8-14-22/h2-16H,17-19H2,1H3 |
| InChIKey | ULKRNBOIGKENHQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|