C24H32N2O4Si — CID 91699647
trimethylsilyl (4Z,6E)-4,6-bis(phenylmethoxyimino)heptanoate (PubChem CID 91699647) has the molecular formula C24H32N2O4Si and a molecular weight of 440.62 g/mol. Its IUPAC name is trimethylsilyl (4Z,6E)-4,6-bis(phenylmethoxyimino)heptanoate.
| Compound Name | trimethylsilyl (4Z,6E)-4,6-bis(phenylmethoxyimino)heptanoate |
|---|---|
| PubChem CID | 91699647 |
| Molecular Formula | C24H32N2O4Si |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | trimethylsilyl (4Z,6E)-4,6-bis(phenylmethoxyimino)heptanoate |
| SMILES | C/C(C/C(CCC(=O)O[Si](C)(C)C)=N\OCc1ccccc1)=N\OCc1ccccc1 |
| InChI | InChI=1S/C24H32N2O4Si/c1-20(25-28-18-21-11-7-5-8-12-21)17-23(15-16-24(27)30-31(2,3)4)26-29-19-22-13-9-6-10-14-22/h5-14H,15-19H2,1-4H3/b25-20+,26-23- |
| InChIKey | QDOIDENPVQBSNT-WHVOXNPRSA-N |
| XLogP | 5.70 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|