C18H36N2O6Si2 — CID 5366431
bis(trimethylsilyl) (3E,5E)-3,5-bis(ethoxyimino)octanedioate (PubChem CID 5366431) has the molecular formula C18H36N2O6Si2 and a molecular weight of 432.67 g/mol. Its IUPAC name is bis(trimethylsilyl) (3E,5E)-3,5-bis(ethoxyimino)octanedioate.
| Compound Name | bis(trimethylsilyl) (3E,5E)-3,5-bis(ethoxyimino)octanedioate |
|---|---|
| PubChem CID | 5366431 |
| Molecular Formula | C18H36N2O6Si2 |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | bis(trimethylsilyl) (3E,5E)-3,5-bis(ethoxyimino)octanedioate |
| SMILES | CCO/N=C(\CCC(=O)O[Si](C)(C)C)C/C(CC(=O)O[Si](C)(C)C)=N\OCC |
| InChI | InChI=1S/C18H36N2O6Si2/c1-9-23-19-15(11-12-17(21)25-27(3,4)5)13-16(20-24-10-2)14-18(22)26-28(6,7)8/h9-14H2,1-8H3/b19-15+,20-16+ |
| InChIKey | REECDQHAAFAXPR-MXWIWYRXSA-N |
| XLogP | 4.09 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|