C17H30N2O2Si2 — CID 87328481
1-phenyl-2-N,4-N-bis(trimethylsilyloxy)pentane-2,4-diimine (PubChem CID 87328481) has the molecular formula C17H30N2O2Si2 and a molecular weight of 350.61 g/mol. Its IUPAC name is 1-phenyl-2-N,4-N-bis(trimethylsilyloxy)pentane-2,4-diimine.
| Compound Name | 1-phenyl-2-N,4-N-bis(trimethylsilyloxy)pentane-2,4-diimine |
|---|---|
| PubChem CID | 87328481 |
| Molecular Formula | C17H30N2O2Si2 |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-phenyl-2-N,4-N-bis(trimethylsilyloxy)pentane-2,4-diimine |
| SMILES | C/C(C/C(Cc1ccccc1)=N\O[Si](C)(C)C)=N\O[Si](C)(C)C |
| InChI | InChI=1S/C17H30N2O2Si2/c1-15(18-20-22(2,3)4)13-17(19-21-23(5,6)7)14-16-11-9-8-10-12-16/h8-12H,13-14H2,1-7H3/b18-15+,19-17+ |
| InChIKey | WRQCFOGDNJRFDV-RZBFYTONSA-N |
| XLogP | 5.05 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|