C13H28N2O3Si2 — CID 173378642
4,6-bis(trimethylsilyloxyimino)heptan-2-one (PubChem CID 173378642) has the molecular formula C13H28N2O3Si2 and a molecular weight of 316.55 g/mol. Its IUPAC name is 4,6-bis(trimethylsilyloxyimino)heptan-2-one.
| Compound Name | 4,6-bis(trimethylsilyloxyimino)heptan-2-one |
|---|---|
| PubChem CID | 173378642 |
| Molecular Formula | C13H28N2O3Si2 |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4,6-bis(trimethylsilyloxyimino)heptan-2-one |
| SMILES | CC(=O)CC(CC(C)=NO[Si](C)(C)C)=NO[Si](C)(C)C |
| InChI | InChI=1S/C13H28N2O3Si2/c1-11(14-17-19(3,4)5)9-13(10-12(2)16)15-18-20(6,7)8/h9-10H2,1-8H3 |
| InChIKey | MMLVDHYQWUGVTJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|