C47H42N2O2Si2 — CID 87327816
1-phenyl-2-N,4-N-bis(triphenylsilyloxy)pentane-2,4-diimine (PubChem CID 87327816) has the molecular formula C47H42N2O2Si2 and a molecular weight of 723.04 g/mol. Its IUPAC name is 1-phenyl-2-N,4-N-bis(triphenylsilyloxy)pentane-2,4-diimine.
| Compound Name | 1-phenyl-2-N,4-N-bis(triphenylsilyloxy)pentane-2,4-diimine |
|---|---|
| PubChem CID | 87327816 |
| Molecular Formula | C47H42N2O2Si2 |
| Molecular Weight | 723.04 g/mol |
| Exact Mass | 722.28 |
| IUPAC Name | 1-phenyl-2-N,4-N-bis(triphenylsilyloxy)pentane-2,4-diimine |
| SMILES | C/C(C/C(Cc1ccccc1)=N\O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)=N/O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H42N2O2Si2/c1-39(48-50-52(42-25-11-3-12-26-42,43-27-13-4-14-28-43)44-29-15-5-16-30-44)37-41(38-40-23-9-2-10-24-40)49-51-53(45-31-17-6-18-32-45,46-33-19-7-20-34-46)47-35-21-8-22-36-47/h2-36H,37-38H2,1H3/b48-39-,49-41+ |
| InChIKey | NBDUVERUFLCILN-UAEYHXPYSA-N |
| XLogP | 6.72 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.04 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|