C42H40N2O2Si2 — CID 154048216
2-N,3-N-bis(triphenylsilyloxy)hexane-2,3-diimine (PubChem CID 154048216) has the molecular formula C42H40N2O2Si2 and a molecular weight of 660.97 g/mol. Its IUPAC name is 2-N,3-N-bis(triphenylsilyloxy)hexane-2,3-diimine.
| Compound Name | 2-N,3-N-bis(triphenylsilyloxy)hexane-2,3-diimine |
|---|---|
| PubChem CID | 154048216 |
| Molecular Formula | C42H40N2O2Si2 |
| Molecular Weight | 660.97 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 2-N,3-N-bis(triphenylsilyloxy)hexane-2,3-diimine |
| SMILES | CCCC(=NO[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)=NO[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H40N2O2Si2/c1-3-22-42(44-46-48(39-29-16-7-17-30-39,40-31-18-8-19-32-40)41-33-20-9-21-34-41)35(2)43-45-47(36-23-10-4-11-24-36,37-25-12-5-13-26-37)38-27-14-6-15-28-38/h4-21,23-34H,3,22H2,1-2H3 |
| InChIKey | FLZYZOIFEFSROB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.97 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|