C70H73N3O3Si3 — CID 141302709
2-N,3-N,4-N-tris(tribenzylsilyloxy)heptane-2,3,4-triimine (PubChem CID 141302709) has the molecular formula C70H73N3O3Si3 and a molecular weight of 1088.63 g/mol. Its IUPAC name is 2-N,3-N,4-N-tris(tribenzylsilyloxy)heptane-2,3,4-triimine.
| Compound Name | 2-N,3-N,4-N-tris(tribenzylsilyloxy)heptane-2,3,4-triimine |
|---|---|
| PubChem CID | 141302709 |
| Molecular Formula | C70H73N3O3Si3 |
| Molecular Weight | 1088.63 g/mol |
| Exact Mass | 1087.50 |
| IUPAC Name | 2-N,3-N,4-N-tris(tribenzylsilyloxy)heptane-2,3,4-triimine |
| SMILES | CCCC(=NO[Si](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1)C(=NO[Si](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1)C(C)=NO[Si](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C70H73N3O3Si3/c1-3-31-69(72-75-78(53-63-38-19-7-20-39-63,54-64-40-21-8-22-41-64)55-65-42-23-9-24-43-65)70(73-76-79(56-66-44-25-10-26-45-66,57-67-46-27-11-28-47-67)58-68-48-29-12-30-49-68)59(2)71-74-77(50-60-32-13-4-14-33-60,51-61-34-15-5-16-35-61)52-62-36-17-6-18-37-62/h4-30,32-49H,3,31,50-58H2,1-2H3 |
| InChIKey | UAUWBBYBQVAUAQ-UHFFFAOYSA-N |
| XLogP | 15.80 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1088.63 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|