About CID 13440858
CID 13440858 (PubChem CID 13440858) has the molecular formula C11H14NSe
and a molecular weight of 239.20 g/mol.
Molecular Properties
| Compound Name | CID 13440858 |
| PubChem CID | 13440858 |
| Molecular Formula | C11H14NSe |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | — |
| SMILES | CCC/C([Se])=N/Cc1ccccc1 |
| InChI | InChI=1S/C11H14NSe/c1-2-6-11(13)12-9-10-7-4-3-5-8-10/h3-5,7-8H,2,6,9H2,1H3/b12-11- |
| InChIKey | RRAKCFSGATUGSN-QXMHVHEDSA-N |
| XLogP | 2.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 13440858 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13440858?
The IUPAC name of CID 13440858 (CID 13440858) is not available.
What is the SMILES notation for CID 13440858?
The canonical SMILES for CID 13440858 is CCC/C([Se])=N/Cc1ccccc1.
What is the InChIKey of CID 13440858?
The InChIKey is RRAKCFSGATUGSN-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H14NSe/c1-2-6-11(13)12-9-10-7-4-3-5-8-10/h3-5,7-8H,2,6,9H2,1H3/b12-11-.
What are the key properties of CID 13440858?
CID 13440858 has a molecular weight of 239.20 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13440858 is sourced from PubChem (CID 13440858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).