About N'-benzylpropanimidamide
N'-benzylpropanimidamide (PubChem CID 45122449) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is N'-benzylpropanimidamide.
Molecular Properties
| Compound Name | N'-benzylpropanimidamide |
| PubChem CID | 45122449 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N'-benzylpropanimidamide |
| SMILES | CC/C(N)=N\Cc1ccccc1 |
| InChI | InChI=1S/C10H14N2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,11,12) |
| InChIKey | CBOYJFTZBXFGRZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-benzylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzylpropanimidamide?
The IUPAC name of N'-benzylpropanimidamide (CID 45122449) is N'-benzylpropanimidamide.
What is the SMILES notation for N'-benzylpropanimidamide?
The canonical SMILES for N'-benzylpropanimidamide is CC/C(N)=N\Cc1ccccc1.
What is the InChIKey of N'-benzylpropanimidamide?
The InChIKey is CBOYJFTZBXFGRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,11,12).
What are the key properties of N'-benzylpropanimidamide?
N'-benzylpropanimidamide has a molecular weight of 162.24 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzylpropanimidamide is sourced from PubChem (CID 45122449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).