C14H21N — CID 15160187
N-benzyl-2,4-dimethylpentan-3-imine (PubChem CID 15160187) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-benzyl-2,4-dimethylpentan-3-imine.
| Compound Name | N-benzyl-2,4-dimethylpentan-3-imine |
|---|---|
| PubChem CID | 15160187 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-benzyl-2,4-dimethylpentan-3-imine |
| SMILES | CC(C)C(=NCc1ccccc1)C(C)C |
| InChI | InChI=1S/C14H21N/c1-11(2)14(12(3)4)15-10-13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3 |
| InChIKey | VUKRGPIQBGYAIG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|