About 3-benzyliminobutanoic acid
3-benzyliminobutanoic acid (PubChem CID 23175618) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-benzyliminobutanoic acid.
Molecular Properties
| Compound Name | 3-benzyliminobutanoic acid |
| PubChem CID | 23175618 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-benzyliminobutanoic acid |
| SMILES | C/C(CC(=O)O)=N\Cc1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c1-9(7-11(13)14)12-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14)/b12-9+ |
| InChIKey | MCOQIYWEEGETRU-FMIVXFBMSA-N |
| XLogP | 2.12 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyliminobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyliminobutanoic acid?
The IUPAC name of 3-benzyliminobutanoic acid (CID 23175618) is 3-benzyliminobutanoic acid.
What is the SMILES notation for 3-benzyliminobutanoic acid?
The canonical SMILES for 3-benzyliminobutanoic acid is C/C(CC(=O)O)=N\Cc1ccccc1.
What is the InChIKey of 3-benzyliminobutanoic acid?
The InChIKey is MCOQIYWEEGETRU-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H13NO2/c1-9(7-11(13)14)12-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14)/b12-9+.
What are the key properties of 3-benzyliminobutanoic acid?
3-benzyliminobutanoic acid has a molecular weight of 191.23 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyliminobutanoic acid is sourced from PubChem (CID 23175618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).