About benzamido 3-benzyliminobutanoate
benzamido 3-benzyliminobutanoate (PubChem CID 7457656) has the molecular formula C18H18N2O3
and a molecular weight of 310.35 g/mol. Its IUPAC name is benzamido 3-benzyliminobutanoate.
Molecular Properties
| Compound Name | benzamido 3-benzyliminobutanoate |
| PubChem CID | 7457656 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | benzamido 3-benzyliminobutanoate |
| SMILES | C/C(CC(=O)ONC(=O)c1ccccc1)=N\Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c1-14(19-13-15-8-4-2-5-9-15)12-17(21)23-20-18(22)16-10-6-3-7-11-16/h2-11H,12-13H2,1H3,(H,20,22)/b19-14+ |
| InChIKey | HURQCJRQACZPNC-XMHGGMMESA-N |
| XLogP | 2.93 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamido 3-benzyliminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido 3-benzyliminobutanoate?
The IUPAC name of benzamido 3-benzyliminobutanoate (CID 7457656) is benzamido 3-benzyliminobutanoate.
What is the SMILES notation for benzamido 3-benzyliminobutanoate?
The canonical SMILES for benzamido 3-benzyliminobutanoate is C/C(CC(=O)ONC(=O)c1ccccc1)=N\Cc1ccccc1.
What is the InChIKey of benzamido 3-benzyliminobutanoate?
The InChIKey is HURQCJRQACZPNC-XMHGGMMESA-N. The full InChI is InChI=1S/C18H18N2O3/c1-14(19-13-15-8-4-2-5-9-15)12-17(21)23-20-18(22)16-10-6-3-7-11-16/h2-11H,12-13H2,1H3,(H,20,22)/b19-14+.
What are the key properties of benzamido 3-benzyliminobutanoate?
benzamido 3-benzyliminobutanoate has a molecular weight of 310.35 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido 3-benzyliminobutanoate is sourced from PubChem (CID 7457656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).