C22H21N3O — CID 155542579
N-[N'-benzyl-N-(4-methylphenyl)carbamimidoyl]benzamide (PubChem CID 155542579) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[N'-benzyl-N-(4-methylphenyl)carbamimidoyl]benzamide.
| Compound Name | N-[N'-benzyl-N-(4-methylphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 155542579 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[N'-benzyl-N-(4-methylphenyl)carbamimidoyl]benzamide |
| SMILES | Cc1ccc(N/C(=N/Cc2ccccc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3O/c1-17-12-14-20(15-13-17)24-22(23-16-18-8-4-2-5-9-18)25-21(26)19-10-6-3-7-11-19/h2-15H,16H2,1H3,(H2,23,24,25,26) |
| InChIKey | WFFNPNMRXGDZCE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|