C21H18ClN3O — CID 139243347
N-[N'-benzyl-N-(4-chlorophenyl)carbamimidoyl]benzamide (PubChem CID 139243347) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is N-[N'-benzyl-N-(4-chlorophenyl)carbamimidoyl]benzamide.
| Compound Name | N-[N'-benzyl-N-(4-chlorophenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 139243347 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[N'-benzyl-N-(4-chlorophenyl)carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\Cc1ccccc1)Nc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H18ClN3O/c22-18-11-13-19(14-12-18)24-21(23-15-16-7-3-1-4-8-16)25-20(26)17-9-5-2-6-10-17/h1-14H,15H2,(H2,23,24,25,26) |
| InChIKey | DPGYWCDRRBNSDX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|