C20H17FN4O — CID 50818460
3-fluoro-N-[N-phenyl-N'-(pyridin-3-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50818460) has the molecular formula C20H17FN4O and a molecular weight of 348.38 g/mol. Its IUPAC name is 3-fluoro-N-[N-phenyl-N'-(pyridin-3-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 3-fluoro-N-[N-phenyl-N'-(pyridin-3-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50818460 |
| Molecular Formula | C20H17FN4O |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-fluoro-N-[N-phenyl-N'-(pyridin-3-ylmethyl)carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\Cc1cccnc1)Nc1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H17FN4O/c21-17-8-4-7-16(12-17)19(26)25-20(24-18-9-2-1-3-10-18)23-14-15-6-5-11-22-13-15/h1-13H,14H2,(H2,23,24,25,26) |
| InChIKey | VJMXADLFVJUJAH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|