C24H26N4O — CID 50818472
N-[N-(3-ethylphenyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]-3,4-dimethylbenzamide (PubChem CID 50818472) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[N-(3-ethylphenyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]-3,4-dimethylbenzamide.
| Compound Name | N-[N-(3-ethylphenyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 50818472 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[N-(3-ethylphenyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]-3,4-dimethylbenzamide |
| SMILES | CCc1cccc(N/C(=N/Cc2cccnc2)NC(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C24H26N4O/c1-4-19-7-5-9-22(14-19)27-24(26-16-20-8-6-12-25-15-20)28-23(29)21-11-10-17(2)18(3)13-21/h5-15H,4,16H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | KCPWFJJGJDVHII-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|