C22H21BrN4O — CID 50818249
N-[N-(4-bromophenyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]-3,4-dimethylbenzamide (PubChem CID 50818249) has the molecular formula C22H21BrN4O and a molecular weight of 437.34 g/mol. Its IUPAC name is N-[N-(4-bromophenyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]-3,4-dimethylbenzamide.
| Compound Name | N-[N-(4-bromophenyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 50818249 |
| Molecular Formula | C22H21BrN4O |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[N-(4-bromophenyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=N\Cc2cccnc2)Nc2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C22H21BrN4O/c1-15-5-6-18(12-16(15)2)21(28)27-22(25-14-17-4-3-11-24-13-17)26-20-9-7-19(23)8-10-20/h3-13H,14H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | BCVXPSUCZWEUAC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|