C24H24N4O3 — CID 50818196
ethyl 4-[[N-(4-methylbenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]amino]benzoate (PubChem CID 50818196) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is ethyl 4-[[N-(4-methylbenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]amino]benzoate.
| Compound Name | ethyl 4-[[N-(4-methylbenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 50818196 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | ethyl 4-[[N-(4-methylbenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N/C(=N/Cc2cccnc2)NC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O3/c1-3-31-23(30)20-10-12-21(13-11-20)27-24(26-16-18-5-4-14-25-15-18)28-22(29)19-8-6-17(2)7-9-19/h4-15H,3,16H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | AJYGEHCUZKZACH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|