C20H16F2N4O — CID 50771443
3,4-difluoro-N-[N-phenyl-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50771443) has the molecular formula C20H16F2N4O and a molecular weight of 366.37 g/mol. Its IUPAC name is 3,4-difluoro-N-[N-phenyl-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 3,4-difluoro-N-[N-phenyl-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50771443 |
| Molecular Formula | C20H16F2N4O |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3,4-difluoro-N-[N-phenyl-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\Cc1ccncc1)Nc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H16F2N4O/c21-17-7-6-15(12-18(17)22)19(27)26-20(25-16-4-2-1-3-5-16)24-13-14-8-10-23-11-9-14/h1-12H,13H2,(H2,24,25,26,27) |
| InChIKey | DLYIMIIQOIMXBF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|