C24H24F2N4O — CID 94072599
N-[N-[4-[(2R)-butan-2-yl]phenyl]-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 94072599) has the molecular formula C24H24F2N4O and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[N-[4-[(2R)-butan-2-yl]phenyl]-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-[4-[(2R)-butan-2-yl]phenyl]-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 94072599 |
| Molecular Formula | C24H24F2N4O |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | N-[N-[4-[(2R)-butan-2-yl]phenyl]-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CC[C@@H](C)c1ccc(N/C(=N/Cc2ccncc2)NC(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C24H24F2N4O/c1-3-16(2)18-4-7-20(8-5-18)29-24(28-15-17-10-12-27-13-11-17)30-23(31)19-6-9-21(25)22(26)14-19/h4-14,16H,3,15H2,1-2H3,(H2,28,29,30,31)/t16-/m1/s1 |
| InChIKey | HHSAOIRSKGVDEA-MRXNPFEDSA-N |
| XLogP | 5.27 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|