C21H16ClFN4O3 — CID 50773278
N-[N-(1,3-benzodioxol-5-yl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3-chloro-4-fluorobenzamide (PubChem CID 50773278) has the molecular formula C21H16ClFN4O3 and a molecular weight of 426.84 g/mol. Its IUPAC name is N-[N-(1,3-benzodioxol-5-yl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3-chloro-4-fluorobenzamide.
| Compound Name | N-[N-(1,3-benzodioxol-5-yl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3-chloro-4-fluorobenzamide |
|---|---|
| PubChem CID | 50773278 |
| Molecular Formula | C21H16ClFN4O3 |
| Molecular Weight | 426.84 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[N-(1,3-benzodioxol-5-yl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3-chloro-4-fluorobenzamide |
| SMILES | O=C(N/C(=N\Cc1ccncc1)Nc1ccc2c(c1)OCO2)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C21H16ClFN4O3/c22-16-9-14(1-3-17(16)23)20(28)27-21(25-11-13-5-7-24-8-6-13)26-15-2-4-18-19(10-15)30-12-29-18/h1-10H,11-12H2,(H2,25,26,27,28) |
| InChIKey | MLSTZGLEWVWYLS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|