C21H17BrN4O3 — CID 50771437
N-[N-(4-bromophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 50771437) has the molecular formula C21H17BrN4O3 and a molecular weight of 453.30 g/mol. Its IUPAC name is N-[N-(4-bromophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[N-(4-bromophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 50771437 |
| Molecular Formula | C21H17BrN4O3 |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | N-[N-(4-bromophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(N/C(=N\Cc1ccncc1)Nc1ccc(Br)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H17BrN4O3/c22-16-2-4-17(5-3-16)25-21(24-12-14-7-9-23-10-8-14)26-20(27)15-1-6-18-19(11-15)29-13-28-18/h1-11H,12-13H2,(H2,24,25,26,27) |
| InChIKey | ORVDMBBMHXZHHM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|