C22H20N4O3 — CID 50773165
N-[N-(1,3-benzodioxol-5-yl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3-methylbenzamide (PubChem CID 50773165) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[N-(1,3-benzodioxol-5-yl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3-methylbenzamide.
| Compound Name | N-[N-(1,3-benzodioxol-5-yl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 50773165 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[N-(1,3-benzodioxol-5-yl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=N\Cc2ccncc2)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C22H20N4O3/c1-15-3-2-4-17(11-15)21(27)26-22(24-13-16-7-9-23-10-8-16)25-18-5-6-19-20(12-18)29-14-28-19/h2-12H,13-14H2,1H3,(H2,24,25,26,27) |
| InChIKey | YJRNLJBFMZNZCJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|