C24H26N4O — CID 50773147
3-methyl-N-[N-(3-propan-2-ylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50773147) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-methyl-N-[N-(3-propan-2-ylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 3-methyl-N-[N-(3-propan-2-ylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50773147 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-methyl-N-[N-(3-propan-2-ylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
| SMILES | Cc1cccc(C(=O)N/C(=N\Cc2ccncc2)Nc2cccc(C(C)C)c2)c1 |
| InChI | InChI=1S/C24H26N4O/c1-17(2)20-7-5-9-22(15-20)27-24(26-16-19-10-12-25-13-11-19)28-23(29)21-8-4-6-18(3)14-21/h4-15,17H,16H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | RXKHIQPHOHEGBX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|