C21H19ClN4OS — CID 50771331
3-chloro-N-[N-(3-methylsulfanylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50771331) has the molecular formula C21H19ClN4OS and a molecular weight of 410.93 g/mol. Its IUPAC name is 3-chloro-N-[N-(3-methylsulfanylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N-(3-methylsulfanylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50771331 |
| Molecular Formula | C21H19ClN4OS |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-chloro-N-[N-(3-methylsulfanylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
| SMILES | CSc1cccc(N/C(=N/Cc2ccncc2)NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H19ClN4OS/c1-28-19-7-3-6-18(13-19)25-21(24-14-15-8-10-23-11-9-15)26-20(27)16-4-2-5-17(22)12-16/h2-13H,14H2,1H3,(H2,24,25,26,27) |
| InChIKey | XKLJVEXMSCAHLO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|