C25H28N4O — CID 50773195
3,5-dimethyl-N-[N-(3-propan-2-ylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50773195) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 3,5-dimethyl-N-[N-(3-propan-2-ylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[N-(3-propan-2-ylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50773195 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3,5-dimethyl-N-[N-(3-propan-2-ylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)N/C(=N\Cc2ccncc2)Nc2cccc(C(C)C)c2)c1 |
| InChI | InChI=1S/C25H28N4O/c1-17(2)21-6-5-7-23(15-21)28-25(27-16-20-8-10-26-11-9-20)29-24(30)22-13-18(3)12-19(4)14-22/h5-15,17H,16H2,1-4H3,(H2,27,28,29,30) |
| InChIKey | XTKXNPPGXSWRAE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|