C24H26N4O5 — CID 46297972
N-[N-(3,5-dimethoxyphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,5-dimethoxybenzamide (PubChem CID 46297972) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[N-(3,5-dimethoxyphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[N-(3,5-dimethoxyphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 46297972 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[N-(3,5-dimethoxyphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(N/C(=N/Cc2ccncc2)NC(=O)c2cc(OC)cc(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H26N4O5/c1-30-19-9-17(10-20(13-19)31-2)23(29)28-24(26-15-16-5-7-25-8-6-16)27-18-11-21(32-3)14-22(12-18)33-4/h5-14H,15H2,1-4H3,(H2,26,27,28,29) |
| InChIKey | XFYMUPWQYCDKQS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|