C22H21FN4O2 — CID 50771285
3-fluoro-N-[N-(4-methoxyphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-4-methylbenzamide (PubChem CID 50771285) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-fluoro-N-[N-(4-methoxyphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-4-methylbenzamide.
| Compound Name | 3-fluoro-N-[N-(4-methoxyphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 50771285 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-fluoro-N-[N-(4-methoxyphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-4-methylbenzamide |
| SMILES | COc1ccc(N/C(=N/Cc2ccncc2)NC(=O)c2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C22H21FN4O2/c1-15-3-4-17(13-20(15)23)21(28)27-22(25-14-16-9-11-24-12-10-16)26-18-5-7-19(29-2)8-6-18/h3-13H,14H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | ISGNXCGWGJWCGB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|