C24H25FN4O — CID 50771217
4-tert-butyl-N-[N-(4-fluorophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide (PubChem CID 50771217) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[N-(4-fluorophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide.
| Compound Name | 4-tert-butyl-N-[N-(4-fluorophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50771217 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 4-tert-butyl-N-[N-(4-fluorophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N/C(=N\Cc2ccncc2)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H25FN4O/c1-24(2,3)19-6-4-18(5-7-19)22(30)29-23(27-16-17-12-14-26-15-13-17)28-21-10-8-20(25)9-11-21/h4-15H,16H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | KFSYEXBISHVXPI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|