C23H23ClN4O3 — CID 46297976
N-[N-(4-chloro-2-methylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,5-dimethoxybenzamide (PubChem CID 46297976) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is N-[N-(4-chloro-2-methylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[N-(4-chloro-2-methylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 46297976 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[N-(4-chloro-2-methylphenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/C(=N\Cc2ccncc2)Nc2ccc(Cl)cc2C)c1 |
| InChI | InChI=1S/C23H23ClN4O3/c1-15-10-18(24)4-5-21(15)27-23(26-14-16-6-8-25-9-7-16)28-22(29)17-11-19(30-2)13-20(12-17)31-3/h4-13H,14H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | UGAWJQHFPXIIPL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|