C23H29ClN4O4 — CID 50819371
N-[N-(4-chloro-2-methylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,5-dimethoxybenzamide (PubChem CID 50819371) has the molecular formula C23H29ClN4O4 and a molecular weight of 460.96 g/mol. Its IUPAC name is N-[N-(4-chloro-2-methylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[N-(4-chloro-2-methylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 50819371 |
| Molecular Formula | C23H29ClN4O4 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[N-(4-chloro-2-methylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/C(=N\CCN2CCOCC2)Nc2ccc(Cl)cc2C)c1 |
| InChI | InChI=1S/C23H29ClN4O4/c1-16-12-18(24)4-5-21(16)26-23(25-6-7-28-8-10-32-11-9-28)27-22(29)17-13-19(30-2)15-20(14-17)31-3/h4-5,12-15H,6-11H2,1-3H3,(H2,25,26,27,29) |
| InChIKey | BYZWCCXMGGMXKC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|