C21H25FN4O3 — CID 50819646
N-[N-(3-fluorophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3-methoxybenzamide (PubChem CID 50819646) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[N-(3-fluorophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3-methoxybenzamide.
| Compound Name | N-[N-(3-fluorophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 50819646 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[N-(3-fluorophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/C(=N\CCN2CCOCC2)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H25FN4O3/c1-28-19-7-2-4-16(14-19)20(27)25-21(24-18-6-3-5-17(22)15-18)23-8-9-26-10-12-29-13-11-26/h2-7,14-15H,8-13H2,1H3,(H2,23,24,25,27) |
| InChIKey | AAZAWVKZUPMUBR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|