C22H25FN4O4 — CID 50819477
methyl 3-[[N-(4-fluorobenzoyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]amino]benzoate (PubChem CID 50819477) has the molecular formula C22H25FN4O4 and a molecular weight of 428.46 g/mol. Its IUPAC name is methyl 3-[[N-(4-fluorobenzoyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]amino]benzoate.
| Compound Name | methyl 3-[[N-(4-fluorobenzoyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 50819477 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | methyl 3-[[N-(4-fluorobenzoyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(N/C(=N/CCN2CCOCC2)NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H25FN4O4/c1-30-21(29)17-3-2-4-19(15-17)25-22(24-9-10-27-11-13-31-14-12-27)26-20(28)16-5-7-18(23)8-6-16/h2-8,15H,9-14H2,1H3,(H2,24,25,26,28) |
| InChIKey | WXBVYGDXVCVYML-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|