C22H27FN4O4 — CID 50819452
N-[N-(4-fluorophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,4-dimethoxybenzamide (PubChem CID 50819452) has the molecular formula C22H27FN4O4 and a molecular weight of 430.48 g/mol. Its IUPAC name is N-[N-(4-fluorophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[N-(4-fluorophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 50819452 |
| Molecular Formula | C22H27FN4O4 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[N-(4-fluorophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=N\CCN2CCOCC2)Nc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C22H27FN4O4/c1-29-19-8-3-16(15-20(19)30-2)21(28)26-22(25-18-6-4-17(23)5-7-18)24-9-10-27-11-13-31-14-12-27/h3-8,15H,9-14H2,1-2H3,(H2,24,25,26,28) |
| InChIKey | GPCAOOOJCZXYNJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|