C21H27N3O4 — CID 112981431
3,4-dimethoxy-N-[4-(2-morpholin-4-ylethylamino)phenyl]benzamide (PubChem CID 112981431) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(2-morpholin-4-ylethylamino)phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[4-(2-morpholin-4-ylethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 112981431 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(2-morpholin-4-ylethylamino)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(NCCN3CCOCC3)cc2)cc1OC |
| InChI | InChI=1S/C21H27N3O4/c1-26-19-8-3-16(15-20(19)27-2)21(25)23-18-6-4-17(5-7-18)22-9-10-24-11-13-28-14-12-24/h3-8,15,22H,9-14H2,1-2H3,(H,23,25) |
| InChIKey | DAFMYKPIARLCPS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |