C28H31FN2O5 — CID 141436174
N-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-4-methoxy-3-phenylmethoxybenzamide (PubChem CID 141436174) has the molecular formula C28H31FN2O5 and a molecular weight of 494.56 g/mol. Its IUPAC name is N-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-4-methoxy-3-phenylmethoxybenzamide.
| Compound Name | N-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-4-methoxy-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 141436174 |
| Molecular Formula | C28H31FN2O5 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-4-methoxy-3-phenylmethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(OCCCN3CCOCC3)c(F)c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C28H31FN2O5/c1-33-26-10-8-22(18-27(26)36-20-21-6-3-2-4-7-21)28(32)30-23-9-11-25(24(29)19-23)35-15-5-12-31-13-16-34-17-14-31/h2-4,6-11,18-19H,5,12-17,20H2,1H3,(H,30,32) |
| InChIKey | IHLCPQVVZGVBFG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|