C28H30FN5O5 — CID 56846737
N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 56846737) has the molecular formula C28H30FN5O5 and a molecular weight of 535.58 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56846737 |
| Molecular Formula | C28H30FN5O5 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4ccn(C)n4)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C28H30FN5O5/c1-33-10-7-22(32-33)28(35)31-19-4-5-25(21(29)16-19)39-24-6-8-30-23-18-27(26(36-2)17-20(23)24)38-13-3-9-34-11-14-37-15-12-34/h4-8,10,16-18H,3,9,11-15H2,1-2H3,(H,31,35) |
| InChIKey | NGUMZWQELVBGHW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|