C33H37FN4O5 — CID 141472643
1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 141472643) has the molecular formula C33H37FN4O5 and a molecular weight of 588.68 g/mol. Its IUPAC name is 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 141472643 |
| Molecular Formula | C33H37FN4O5 |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 1-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)Nc4ccc(C(C)C)cc4)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C33H37FN4O5/c1-22(2)23-5-7-24(8-6-23)36-33(39)37-25-9-10-30(27(34)19-25)43-29-11-12-35-28-21-32(31(40-3)20-26(28)29)42-16-4-13-38-14-17-41-18-15-38/h5-12,19-22H,4,13-18H2,1-3H3,(H2,36,37,39) |
| InChIKey | SMZPDSDSEGUGED-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|