C34H34ClFN4O6 — CID 24864513
1-(4-chlorophenyl)-N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 24864513) has the molecular formula C34H34ClFN4O6 and a molecular weight of 649.12 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 24864513 |
| Molecular Formula | C34H34ClFN4O6 |
| Molecular Weight | 649.12 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4CCN(c5ccc(Cl)cc5)C4=O)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C34H34ClFN4O6/c1-43-31-20-26-28(21-32(31)45-16-2-12-39-14-17-44-18-15-39)37-11-9-29(26)46-30-8-5-23(19-27(30)36)38-33(41)25-10-13-40(34(25)42)24-6-3-22(35)4-7-24/h3-9,11,19-21,25H,2,10,12-18H2,1H3,(H,38,41) |
| InChIKey | HCRKLKXMWARSLU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.12 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|